|
|
| | 3-IODOPHENYLACETONITRILE Basic information |
| | 3-IODOPHENYLACETONITRILE Chemical Properties |
| Melting point | 34-38 °C(lit.) | | Boiling point | 138°C 12mm | | Fp | 138°C/12mm | | storage temp. | 2-8°C(protect from light) | | solubility | soluble in Methanol | | form | powder to lump | | color | White to Light yellow to Light orange | | Water Solubility | Insoluble in water | | Sensitive | Light Sensitive | | BRN | 7350695 | | InChI | InChI=1S/C8H6IN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4H2 | | InChIKey | LVOKGAHCTHNWIL-UHFFFAOYSA-N | | SMILES | C1(CC#N)=CC=CC(I)=C1 | | CAS DataBase Reference | 130723-54-5(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36/37/38-21/22 | | Safety Statements | 36/37 | | RIDADR | 3439 | | WGK Germany | 3 | | HS Code | 2926.90.4801 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral |
| | 3-IODOPHENYLACETONITRILE Usage And Synthesis |
| Uses | 3-Iodophenylacetonitrile is a important organic intermediate. It is used in agrochemical, pharmaceutical and dyestuff field. |
| | 3-IODOPHENYLACETONITRILE Preparation Products And Raw materials |
|