CHEMBRDG-BB 9040288 manufacturers
|
| | CHEMBRDG-BB 9040288 Basic information |
| Product Name: | CHEMBRDG-BB 9040288 | | Synonyms: | CHEMBRDG-BB 9040288;3-CHLORO-4-PROPOXYBENZOIC ACID;3-chloro-4-propoxybenzoic acid(SALTDATA: FREE);3-chloro-4-propoxybenzoic;Benzoic acid, 3-chloro-4-propoxy- | | CAS: | 76327-32-7 | | MF: | C10H11ClO3 | | MW: | 214.65 | | EINECS: | | | Product Categories: | | | Mol File: | 76327-32-7.mol |  |
| | CHEMBRDG-BB 9040288 Chemical Properties |
| Boiling point | 330.2±22.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 4.11±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H11ClO3/c1-2-5-14-9-4-3-7(10(12)13)6-8(9)11/h3-4,6H,2,5H2,1H3,(H,12,13) | | InChIKey | WOBLCPMGDGMEBX-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OCCC)C(Cl)=C1 |
| | CHEMBRDG-BB 9040288 Usage And Synthesis |
| | CHEMBRDG-BB 9040288 Preparation Products And Raw materials |
|