|
|
| | 3-Mercapto-2-methylpenta-1-ol Basic information |
| Product Name: | 3-Mercapto-2-methylpenta-1-ol | | Synonyms: | 3 - mercaptoacetic - 2 - methyl alcohol e;3-MERCAPTO-2-METHYLPENTANOL;3-Mercapto-2-methylpenta-1-ol;2-Methyl-3-sulfanylpentan-1-ol;3-MERCAPTO-2-METHYLPENTAN-1-OL (RACEMIC);1-Pentanol,3-mercapto-2-methyl-;3-Mercapto-2-methyl-1-pentanol;3-Mercapto-2-methyl-1-pentanol (mixture of diastereoisomers) | | CAS: | 227456-27-1 | | MF: | C6H14OS | | MW: | 134.24 | | EINECS: | 927-385-6 | | Product Categories: | thiol Flavor | | Mol File: | 227456-27-1.mol |  |
| | 3-Mercapto-2-methylpenta-1-ol Chemical Properties |
| Boiling point | 205.0±23.0 °C(Predicted) | | density | 0.959±0.06 g/cm3(Predicted) | | FEMA | 3996 | 3-MERCAPTO-2-METHYLPENTAN-1-OL (RACEMIC) | | pka | 10.50±0.10(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | Odor | at 0.10 % in propylene glycol. sulfurous onion | | Odor Type | sulfurous | | JECFA Number | 1291 | | InChI | InChI=1S/C6H14OS/c1-3-6(8)5(2)4-7/h5-8H,3-4H2,1-2H3 | | InChIKey | HABNNYNSJFKZFE-UHFFFAOYSA-N | | SMILES | C(O)C(C)C(S)CC | | LogP | 1.46 |
| | 3-Mercapto-2-methylpenta-1-ol Usage And Synthesis |
| Chemical Properties | 3-Mercapto-2-methylpentan-1-ol (racemic) is a highly odorous mercaptan with an onion or leek-like aroma. Flavor
quality was reported to strongly depend on concentration. | | Occurrence | Reportedly present in onion. | | Definition | ChEBI: 3-Mercapto-2-methylpentanol is an alkanethiol. | | Preparation | Prepared by a highly diastereoselective aldol reaction using a chiral auxiliary process with further derivatization yielding
the enantiopure compound. | | Aroma threshold values | At low concentrations (0.5 ppb), a pleasant, meat-broth, sweaty, onion and leek-like odor can be perceived. |
| | 3-Mercapto-2-methylpenta-1-ol Preparation Products And Raw materials |
|