| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
6-Chloro-[3,4']-bipyridine manufacturers
|
| | 6-Chloro-[3,4']-bipyridine Basic information |
| Product Name: | 6-Chloro-[3,4']-bipyridine | | Synonyms: | 2-Chlor-5-(pyrid-4-yl)pyridin;3,4'-Bipyridine,6-chloro-;6-Chloro-3,4′-bipyridine, CAS 79739-22-3;6-Chloro-[3,4']-bipyridine | | CAS: | 79739-22-3 | | MF: | C10H7ClN2 | | MW: | 190.63 | | EINECS: | | | Product Categories: | | | Mol File: | 79739-22-3.mol | ![6-Chloro-[3,4']-bipyridine Structure](CAS/GIF/79739-22-3.gif) |
| | 6-Chloro-[3,4']-bipyridine Chemical Properties |
| Melting point | 160-162 °C(Solv: dichloromethane (75-09-2)) | | Boiling point | 323.1±27.0 °C(Predicted) | | density | 1.245±0.06 g/cm3(Predicted) | | pka | 3.18±0.10(Predicted) | | InChI | InChI=1S/C10H7ClN2/c11-10-2-1-9(7-13-10)8-3-5-12-6-4-8/h1-7H | | InChIKey | AZESIBFJNSNUBT-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=CC=C1C1C=CN=CC=1 |
| | 6-Chloro-[3,4']-bipyridine Usage And Synthesis |
| | 6-Chloro-[3,4']-bipyridine Preparation Products And Raw materials |
|