| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (2S)-4-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybutanoic acid Basic information |
| | (2S)-4-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybutanoic acid Chemical Properties |
| Melting point | 157-159 °C(lit.) | | Boiling point | 392.32°C (rough estimate) | | density | 1.3189 (rough estimate) | | refractive index | 6 ° (C=1, MeOH) | | storage temp. | Sealed in dry,Room Temperature | | solubility | almost transparency in Methanol | | form | powder to crystal | | pka | 3.67±0.10(Predicted) | | color | White to Almost white | | Optical Rotation | [α]20/D +6.5°, c =1 in ethanol | | InChI | 1S/C12H11NO5/c14-9(12(17)18)5-6-13-10(15)7-3-1-2-4-8(7)11(13)16/h1-4,9,14H,5-6H2,(H,17,18)/t9-/m0/s1 | | InChIKey | YWDXODQRCDEZLN-VIFPVBQESA-N | | SMILES | O[C@@H](CCN1C(=O)c2ccccc2C1=O)C(O)=O | | CAS DataBase Reference | 48172-10-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | HS Code | 29335995 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (2S)-4-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybutanoic acid Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (S)-(+)-2-Hydroxy-4-phthalimidobutyric Acid is used in preparation method of plazomicin key intermediate for simplifying operation and improving yield. |
| | (2S)-4-(1,3-Dioxoisoindolin-2-yl)-2-hydroxybutanoic acid Preparation Products And Raw materials |
|