|
|
| | N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol Basic information |
| Product Name: | N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol | | Synonyms: | 2-[2-(2-Hydroxyethoxy)-4-Nitrophenyl]AminoEthanol(HcYellow4);Ethanol, 2-2-(2-hydroxyethoxy)-4-nitrophenylamino-;2-((2-(2-hydroxyethoxy)-4-nitrophenyl)amino)-ethano;2-[[2-(2-hydroxyethoxy)-4-nitrophenyl]amino]-ethano;Ccris 4258;2-{[2-(2-hydroxyethoxy)-4-nitrophenyl]aMino}ethan-1-ol;2-[2-(2-Hydroxyethoxy)-4-nitroanilino]ethanol;2-(3-Nitro-6-(beta-hydroxyethylamino)phenoxy)ethanol | | CAS: | 59820-43-8 | | MF: | C10H14N2O5 | | MW: | 242.23 | | EINECS: | | | Product Categories: | | | Mol File: | 59820-43-8.mol |  |
| | N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol Chemical Properties |
| Melting point | 142-145℃ | | Boiling point | 385.05°C (rough estimate) | | density | 1.3129 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.12±0.10(Predicted) | | color | Yellow | | Cosmetics Ingredients Functions | HAIR DYEING | | Cosmetic Ingredient Review (CIR) | N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol (59820-43-8) | | InChI | InChI=1S/C10H14N2O5/c13-4-3-11-9-2-1-8(12(15)16)7-10(9)17-6-5-14/h1-2,7,11,13-14H,3-6H2 | | InChIKey | PNENOUKIPPERMY-UHFFFAOYSA-N | | SMILES | C(O)CNC1=CC=C([N+]([O-])=O)C=C1OCCO | | IARC | 3 (Vol. 57) 1993 | | EPA Substance Registry System | HC Yellow No. 4 (59820-43-8) |
| | N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol Usage And Synthesis |
| Description | HC Yellow No. 4 is the hair color | | Chemical Properties | Brilliant yellow powder | | Definition | ChEBI: HC Yellow No. 4 is a C-nitro compound. | | General Description | Canary yellow fluffy powder. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol may be sensitive to prolonged exposure to light. | | Fire Hazard | Flash point data for N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol are not available; however, N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol is probably combustible. |
| | N,O-Di(2-hydroxyethyl)-2-amino-5-nitrophenol Preparation Products And Raw materials |
|