|
|
| | β-Alanine, N,N-dimethyl-, (10Z,13Z)-1-(9Z,12Z)-9,12-octadecadien-1-yl-10,13-nonadecadien-1-yl ester Basic information |
| Product Name: | β-Alanine, N,N-dimethyl-, (10Z,13Z)-1-(9Z,12Z)-9,12-octadecadien-1-yl-10,13-nonadecadien-1-yl ester | | Synonyms: | β-Alanine, N,N-dimethyl-, (10Z,13Z)-1-(9Z,12Z)-9,12-octadecadien-1-yl-10,13-nonadecadien-1-yl ester;(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl 3-(dimethylamino)propanoate;DLin-M-K-DMA;DLin-MC2-DMA | | CAS: | 1221271-55-1 | | MF: | C42H77NO2 | | MW: | 628.08 | | EINECS: | | | Product Categories: | | | Mol File: | 1221271-55-1.mol |  |
| | β-Alanine, N,N-dimethyl-, (10Z,13Z)-1-(9Z,12Z)-9,12-octadecadien-1-yl-10,13-nonadecadien-1-yl ester Chemical Properties |
| Boiling point | 660.1±43.0 °C(Predicted) | | density | 0.887±0.06 g/cm3(Predicted) | | solubility | Chloroform: Slightly soluble
Ethanol: 10 mg/ml
Methanol: Slightly soluble | | pka | 8.74±0.28(Predicted) | | form | Liquid | | color | Colorless to light yellow | | InChIKey | BAHNSDYHBUZBBI-KWXKLSQISA-N | | SMILES | C(CCCCCCCC/C=C\C/C=C\CCCCC)(CCCCCCCC/C=C\C/C=C\CCCCC)OC(=O)CCN(C)C |
| | β-Alanine, N,N-dimethyl-, (10Z,13Z)-1-(9Z,12Z)-9,12-octadecadien-1-yl-10,13-nonadecadien-1-yl ester Usage And Synthesis |
| Description | DLin-MC2-DMA, also known as O-3082, is an ionizable lipid. It is useful for Development of Lipidoid Nanoparticles for siRNA, mRNA, and vaccine delivery. | | Uses | DLin-M-K-DMA (DLin-M-C2-DMA) is a cationic lipid that can be used in the construction of biological delivery vectors[1]. | | References | [1] Michael J, et al. Improved amino lipids and methods for the delivery of nucleic acids. WO2010042877A1.
[2] DR. MUTHUSAMY JAYARAMAN. Maximizing the Potency of siRNA Lipid Nanoparticles for Hepatic Gene Silencing In Vivo**[J]. Angewandte Chemie International Edition, 2012, 51 34: 8529-8533. DOI: 10.1002/anie.201203263 |
| | β-Alanine, N,N-dimethyl-, (10Z,13Z)-1-(9Z,12Z)-9,12-octadecadien-1-yl-10,13-nonadecadien-1-yl ester Preparation Products And Raw materials |
|