| Company Name: |
Hu Bei Jiutian Bio-medical Technology CO.,Ltd |
| Tel: |
027-88013699 17354350817 |
| Email: |
Ryan@jiutian-bio.com |
| Products Intro: |
Product Name:Androsta-1,4-diene-3,17-dione,11-hydroxy-, (11a)-
CAS:7801-18-5
Purity:0.99 Package:25kg,50kg,180kg,200kg,250kg,1000kg,as your needs Remarks:as your needs
|
|
|
|
|
|
| | 11alpha-hydroxyandrosta-1,4-diene-3,17-dione Basic information |
| Product Name: | 11alpha-hydroxyandrosta-1,4-diene-3,17-dione | | Synonyms: | 11alpha-hydroxyandrosta-1,4-diene-3,17-dione;(8S,9S,10R,11R,13S,14S)-11-hydroxy-10,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-dione;11-hydroxy-1,4-androstadiene-3,17-dione;11α-Hydroxyandrosta-1,4-diene-3,17-dione;11α-Hydroxyandrosta-1,4-dien-3,17-dione;Androsta-1,4-diene-3,17-dione, 11-hydroxy-, (11α)-;Androsta-1,4-diene-3,17-dione,11-hydroxy-, (11a)-;11α-Hydroxyandrosta-1,4-dien-3,17-dione, CAS 7801-18-5 | | CAS: | 7801-18-5 | | MF: | C19H24O3 | | MW: | 300.39206 | | EINECS: | 2322566 | | Product Categories: | Miscellaneous Reagents, Pharmaceuticals, Intermediates & Fine Chemicals, Steroids | | Mol File: | 7801-18-5.mol |  |
| | 11alpha-hydroxyandrosta-1,4-diene-3,17-dione Chemical Properties |
| Melting point | 190-192 °C | | Boiling point | 479.0±45.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | pka | 14.39±0.60(Predicted) | | InChI | InChI=1/C19H24O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h7-9,13-15,17,21H,3-6,10H2,1-2H3/t13-,14-,15+,17+,18-,19-/s3 | | InChIKey | ZHOLUHXKCIXGSR-GLWAQQFCNA-N | | SMILES | C[C@]12C=CC(=O)C=C1CC[C@@]1([H])[C@]3([H])CCC(=O)[C@@]3(C)C[C@@H](O)[C@]21[H] |&1:1,10,12,18,21,23,r| |
| | 11alpha-hydroxyandrosta-1,4-diene-3,17-dione Usage And Synthesis |
| Uses | 11α-Hydroxyandrosta-1,4-dien-3,17-dione is a metabolite of Testosterone (T155000), a principal hormone in the testes. Also used in the preparation of anti-osteoporosis active compounds. | | Definition | ChEBI: 11alpha-Hydroxyandrosta-1,4-diene-3,17-dione is a 3-hydroxy steroid. It has a role as an androgen. |
| | 11alpha-hydroxyandrosta-1,4-diene-3,17-dione Preparation Products And Raw materials |
|