|
|
| | (1S,2S)-(+)-N,N-Dimethylcyclohexane-1,2-diamine Basic information |
| Product Name: | (1S,2S)-(+)-N,N-Dimethylcyclohexane-1,2-diamine | | Synonyms: | (1S,2S)-N1,N1-Dimethyl-1,2-cyclohexanediamine;(1S,2S)-(+)-N,N-Dimethyl diaminocyclohexane;(1S,2S)-(+)-N,N-Dimethylcyclohexane-1,2-diamine;1R,2R-(-)-OR1S,2S-(+)-N,N-DIAMINOCYCLOHEXANE;N,N'-Dimethyl-1S,2S-Diaminocyclohexane;(1S,2S)-1-N,1-N-diMethylcyclohexane-1,2-diaMine;1S,2S-(+)-N,N-diaminocyclohexane;(1S,2S)-N',N'-Dimethyl-1,2-diaminocyclohexane,99%e.e. | | CAS: | 894493-95-9 | | MF: | C8H18N2 | | MW: | 142.24 | | EINECS: | | | Product Categories: | | | Mol File: | 894493-95-9.mol |  |
| | (1S,2S)-(+)-N,N-Dimethylcyclohexane-1,2-diamine Chemical Properties |
| Boiling point | 180 °C | | density | 0.92 | | Fp | 62 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 10.52±0.70(Predicted) | | form | liquid | | color | Colourless | | InChI | InChI=1S/C8H18N2/c1-10(2)8-6-4-3-5-7(8)9/h7-8H,3-6,9H2,1-2H3/t7-,8-/m0/s1 | | InChIKey | FRDZGSBXKJXGNR-YUMQZZPRSA-N | | SMILES | [C@H]1(N(C)C)CCCC[C@@H]1N |
| Risk Statements | 22-34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 2735 | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 29130000 |
| | (1S,2S)-(+)-N,N-Dimethylcyclohexane-1,2-diamine Usage And Synthesis |
| Chemical Properties | Colorless liquid |
| | (1S,2S)-(+)-N,N-Dimethylcyclohexane-1,2-diamine Preparation Products And Raw materials |
|