|
|
| | Beta-Naphthylacetic acid,methyl ester Basic information |
| Product Name: | Beta-Naphthylacetic acid,methyl ester | | Synonyms: | Beta-Naphthylacetic acid,methyl ester;2-Naphthaleneacetic acid methyl ester;methyl 2-(naphthalen-2-yl)acetate;Methyl2-naphthylacetate;methyl 2-(2-naphthyl)acetate;Methyl 2-naphthaleneacetate;(2-naphthyl)acetic acidmethyl ester | | CAS: | 2876-71-3 | | MF: | C13H12O2 | | MW: | 200.23 | | EINECS: | | | Product Categories: | | | Mol File: | 2876-71-3.mol |  |
| | Beta-Naphthylacetic acid,methyl ester Chemical Properties |
| Melting point | 51-53 °C | | Boiling point | 136 °C | | density | 1.135±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | solid | | Appearance | Yellow to brown Liquid | | InChI | 1S/C13H12O2/c1-15-13(14)9-10-6-7-11-4-2-3-5-12(11)8-10/h2-8H,9H2,1H3 | | InChIKey | BGYOCQOJCMPTCY-UHFFFAOYSA-N | | SMILES | O=C(OC)CC1=CC(C=CC=C2)=C2C=C1 |
| WGK Germany | WGK 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids |
| | Beta-Naphthylacetic acid,methyl ester Usage And Synthesis |
| | Beta-Naphthylacetic acid,methyl ester Preparation Products And Raw materials |
|