| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Methyl 4-(2-acetylaminoethyl)benzoate Basic information |
| | Methyl 4-(2-acetylaminoethyl)benzoate Chemical Properties |
| Melting point | 89-93 °C | | form | solid | | InChI | 1S/C12H15NO3/c1-9(14)13-8-7-10-3-5-11(6-4-10)12(15)16-2/h3-6H,7-8H2,1-2H3,(H,13,14) | | InChIKey | NNHJGOJEUOUOFH-UHFFFAOYSA-N | | SMILES | COC(=O)c1ccc(CCNC(C)=O)cc1 |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-36/37/39 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | Methyl 4-(2-acetylaminoethyl)benzoate Usage And Synthesis |
| | Methyl 4-(2-acetylaminoethyl)benzoate Preparation Products And Raw materials |
|