| Company Name: |
Shijiazhuang Le 'en Fine Chemical Co. LTD
|
| Tel: |
15203111882 |
| Email: |
fengxingwuying11@163.com |
| Products Intro: |
Product Name:N,N-dibenzyl-1,1-dimethoxymethanamine CAS:199003-54-8 Purity:95% Package:1kg/RMB 1;100kg/RMB 1;1000kg/RMB 1
|
Benzenemethanamine, N-(dimethoxymethyl)-N-(phenylmethyl)- manufacturers
|
| | Benzenemethanamine, N-(dimethoxymethyl)-N-(phenylmethyl)- Basic information |
| | Benzenemethanamine, N-(dimethoxymethyl)-N-(phenylmethyl)- Chemical Properties |
| Boiling point | 342.2±32.0 °C(Predicted) | | density | 1.073±0.06 g/cm3(Predicted) | | pka | 3.10±0.50(Predicted) | | InChI | InChI=1S/C17H21NO2/c1-19-17(20-2)18(13-15-9-5-3-6-10-15)14-16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3 | | InChIKey | KDMLAMZWWKELQT-UHFFFAOYSA-N | | SMILES | C1(CN(C(OC)OC)CC2=CC=CC=C2)=CC=CC=C1 |
| | Benzenemethanamine, N-(dimethoxymethyl)-N-(phenylmethyl)- Usage And Synthesis |
| | Benzenemethanamine, N-(dimethoxymethyl)-N-(phenylmethyl)- Preparation Products And Raw materials |
|