| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(Benzyloxy)broMobenzene Basic information |
| | 2-(Benzyloxy)broMobenzene Chemical Properties |
| Boiling point | 100 °C(Press: 0.06 Torr) | | density | 1.382±0.06 g/cm3(Predicted) | | refractive index | n20/D >1.6060(lit.) | | Fp | >230 °F | | storage temp. | Store at room temperature | | solubility | Chloroform, Dichloromethane, Ethyl Acetate | | form | Oil | | color | Colorless | | InChI | InChI=1S/C13H11BrO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-9H,10H2 | | InChIKey | NBHAHMHUMMWFPJ-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=CC=C1OCC1=CC=CC=C1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(Benzyloxy)broMobenzene Usage And Synthesis |
| Chemical Properties | Colorless Oil | | Uses | 2-(Benzyloxy)broMobenzene can be used in the preparation of different inhibitors. |
| | 2-(Benzyloxy)broMobenzene Preparation Products And Raw materials |
|