|
|
| | Carbamic acid, (3-hydroxy-1,1-dimethylpropyl)-, 1,1-dimethylethyl ester (9CI) Basic information |
| Product Name: | Carbamic acid, (3-hydroxy-1,1-dimethylpropyl)-, 1,1-dimethylethyl ester (9CI) | | Synonyms: | Carbamic acid, (3-hydroxy-1,1-dimethylpropyl)-, 1,1-dimethylethyl ester (9CI);Carbamic acid, (3-hydroxy-1,1-dimethylpropyl)-, 1,1-dimethylethyl ester;3-(Boc-amino)-3-methyl-1-butanol;N-(4-hydroxy-2-methylbutan-2-yl)carbamic acid tert-butyl ester;N-Boc-3-amino-3-methyl-butan-1-ol;Carbamic acid, N-(3-hydroxy-1,1-dimethylpropyl)-, 1,1-dimethylethyl ester;tert-butyl (4-hydroxy-2-methylbutan-2-yl)carbamate | | CAS: | 167216-22-0 | | MF: | C10H21NO3 | | MW: | 203.28 | | EINECS: | | | Product Categories: | N-BOC | | Mol File: | 167216-22-0.mol |  |
| | Carbamic acid, (3-hydroxy-1,1-dimethylpropyl)-, 1,1-dimethylethyl ester (9CI) Chemical Properties |
| Boiling point | 311.0±25.0 °C(Predicted) | | density | 0.998±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 12.62±0.46(Predicted) | | color | Colourless | | InChI | InChI=1S/C10H21NO3/c1-9(2,3)14-8(13)11-10(4,5)6-7-12/h12H,6-7H2,1-5H3,(H,11,13) | | InChIKey | QHSUFODBDZQCHO-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC(C)(C)CCO |
| | Carbamic acid, (3-hydroxy-1,1-dimethylpropyl)-, 1,1-dimethylethyl ester (9CI) Usage And Synthesis |
| Uses | 3-(Boc-amino)-3-methyl-1-butanol is an intermediate used in the synthesis of (2E)-5-(tert-Butyloxycarbonylamino)-5-methylhex-2-enoic Acid (B809765), which is used in the preparation of C-terminal sulfonamide analogs of NN703 as growth hormone secretagogues. |
| | Carbamic acid, (3-hydroxy-1,1-dimethylpropyl)-, 1,1-dimethylethyl ester (9CI) Preparation Products And Raw materials |
|