| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,6-Dichlorobenzenesulfonyl chloride Basic information |
| Product Name: | 2,6-Dichlorobenzenesulfonyl chloride | | Synonyms: | 2,6-DICHLOROBENZENE-1-SULFONYL CHLORIDE;2,6-DICHLOROBENZENESULPHONYL CHLORIDE;BUTTPARK 37\11-63;BENZENESULFONYL CHLORIDE, 2,6-DICHLORO-;2,6-Dichlorobenzene-1-sulfonyl chloride, 95+%;2,6-Dichlorobenzenesulphonyl chloride 98%;2,6-DICHLORO PHENYLSULFONYL CHLORIDE;2,6-Dichlorobenzenes | | CAS: | 6579-54-0 | | MF: | C6H3Cl3O2S | | MW: | 245.51 | | EINECS: | 627-349-7 | | Product Categories: | Benzenesulfonyl chloride;Organic Building Blocks;Sulfonyl Halides;Sulfur Compounds;Boron, Nitrile, Thio,& TM-Cpds;Halides | | Mol File: | 6579-54-0.mol |  |
| | 2,6-Dichlorobenzenesulfonyl chloride Chemical Properties |
| Melting point | 53-56 °C (lit.) | | Boiling point | 326.0±32.0 °C(Predicted) | | density | 1.636±0.06 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | color | White to Light yellow | | Water Solubility | Reacts with water. | | Sensitive | Moisture Sensitive | | BRN | 1531023 | | InChI | 1S/C6H3Cl3O2S/c7-4-2-1-3-5(8)6(4)12(9,10)11/h1-3H | | InChIKey | WGGKQIKICKLWGN-UHFFFAOYSA-N | | SMILES | Clc1cccc(Cl)c1S(Cl)(=O)=O | | CAS DataBase Reference | 6579-54-0(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 1759 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 2,6-Dichlorobenzenesulfonyl chloride Usage And Synthesis |
| Uses | 2,6-Dichlorobenzenesulfonyl chloride is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. | | General Description | 2,6-Dichlorobenzenesulfonyl chloride, also known as 2,6-dichlorophenylsulfonyl chloride, is an aryl sulfonyl chloride derivative. | | Synthesis | a) To 200 mL of mixed solvent (acetic acid/water/dichloromethane, 3/1/4 by volume) were added 2,6-dichlorothiophenol (10.0 g, 55.8 mmol), N-chlorosuccinimide (37.28 g, 279 mmol) and potassium acetate (2.29 g, 27.9 mmol). The reaction mixture was stirred at 0 °C and subsequently heated to room temperature. After completion of the reaction, the mixture was diluted with 200 mL of dichloromethane and washed three times with 100 mL of water. The organic layer was dried with anhydrous sodium sulfate and concentrated to give 2,6-dichlorobenzenesulfonyl chloride (11 g, 80% yield). The product was confirmed by NMR hydrogen spectroscopy (CDCl3): δ 7.57 (d, 2H), 7.47 (t, 1H). | | References | [1] Patent: US2003/78250, 2003, A1 [2] Patent: US2003/65170, 2003, A1 [3] Patent: US2003/65188, 2003, A1 [4] Patent: US2003/55286, 2003, A1 |
| | 2,6-Dichlorobenzenesulfonyl chloride Preparation Products And Raw materials |
|