|
|
| | iso-Malathion Basic information |
| Product Name: | iso-Malathion | | Synonyms: | (methoxy(methylthio)phosphinothioyl)butanedioicaciddiethylester;Diethyl (2RS)-2-[(methoxy)(methylsulfanyl)-S-phosphinothioyl]butanedioate;S-(1,2-dicarboethoxyethyl)O,S-dimethyl phosphorodithioate;8063hc;butanedioicacid,((methoxy(methylthio)phosphinothioyl)thio)diethylester;mercaptosuccinicaciddiethylester,s-esterwitho,s-dimethylphosphorodithio;s-methylmalathion;succinicacid,mercapto-,diethylester,s-esterwitho,s-dimethylphosphorodit | | CAS: | 3344-12-5 | | MF: | C10H19O6PS2 | | MW: | 330.36 | | EINECS: | 204-497-7 | | Product Categories: | IEnvironmental Standards;Alphabetic;Analytical Standards;Metabolites;Pesticides&Metabolites | | Mol File: | 3344-12-5.mol |  |
| | iso-Malathion Chemical Properties |
| Boiling point | 413.6±55.0 °C(Predicted) | | density | 1.273±0.06 g/cm3(Predicted) | | Fp | 61℃ | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C10H19O6PS2/c1-5-15-9(11)7-8(10(12)16-6-2)19-17(13,14-3)18-4/h8H,5-7H2,1-4H3 | | InChIKey | LPQDGVLVYVULMX-UHFFFAOYSA-N | | SMILES | [P](=O)(SC(CC(=O)OCC)C(=O)OCC)(SC)OC | | EPA Substance Registry System | Isomalathion (3344-12-5) |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53-43 | | Safety Statements | 24-60-61-46-37 | | RIDADR | UN 1208 3/PG 2 | | WGK Germany | WGK 3 | | RTECS | WM8425000 | | HS Code | 2930904397 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | iso-Malathion Usage And Synthesis |
| Uses | Isomalathion is a major impurity in the synthesis of Malathion (M111000), a commonly used insecticide. |
| | iso-Malathion Preparation Products And Raw materials |
|