Cyclopentanecarboxylic acid, 1-cyano-, methyl ester (9CI) manufacturers
|
| | Cyclopentanecarboxylic acid, 1-cyano-, methyl ester (9CI) Basic information |
| | Cyclopentanecarboxylic acid, 1-cyano-, methyl ester (9CI) Chemical Properties |
| Boiling point | 80°@0.7mm | | density | 1.09±0.1 g/cm3 (20 ºC 760 Torr) | | Fp | 107.7±9.4℃ | | InChI | InChI=1S/C8H11NO2/c1-11-7(10)8(6-9)4-2-3-5-8/h2-5H2,1H3 | | InChIKey | HMAJNDDGAHBMQO-UHFFFAOYSA-N | | SMILES | C1(C#N)(C(OC)=O)CCCC1 |
| HazardClass | IRRITANT | | HS Code | 2926907090 |
| | Cyclopentanecarboxylic acid, 1-cyano-, methyl ester (9CI) Usage And Synthesis |
| | Cyclopentanecarboxylic acid, 1-cyano-, methyl ester (9CI) Preparation Products And Raw materials |
|