| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Piperazine, 1,3,3-trimethyl- (9CI) Basic information |
| Product Name: | Piperazine, 1,3,3-trimethyl- (9CI) | | Synonyms: | Piperazine, 1,3,3-trimethyl- (9CI);1,3,3-TriMethylpiperazine dihydrochloride;Piperazine, 1,3,3-trimethyl-;1,3,3-TriMethylpiperazine | | CAS: | 741288-57-3 | | MF: | C7H16N2 | | MW: | 128.22 | | EINECS: | | | Product Categories: | PIPERAZINE;AMINETERTIARY | | Mol File: | 741288-57-3.mol |  |
| | Piperazine, 1,3,3-trimethyl- (9CI) Chemical Properties |
| Boiling point | 152.5±8.0 °C(Predicted) | | density | 0.843±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 9.40±0.40(Predicted) | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H16N2/c1-7(2)6-9(3)5-4-8-7/h8H,4-6H2,1-3H3 | | InChIKey | KVWMFPQRDKFZMP-UHFFFAOYSA-N | | SMILES | N1(C)CCNC(C)(C)C1 |
| Hazard Codes | Xn | | Risk Statements | 22-36-43 | | Safety Statements | 26-36/37 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Sens. 1 |
| | Piperazine, 1,3,3-trimethyl- (9CI) Usage And Synthesis |
| | Piperazine, 1,3,3-trimethyl- (9CI) Preparation Products And Raw materials |
|