| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
OSU6162hydrochloride manufacturers
|
| | OSU6162hydrochloride Basic information |
| Product Name: | OSU6162hydrochloride | | Synonyms: | PNU-96391;OSU6162hydrochloride;(3S)-3-[3-(Methylsulfonyl)phenyl]-1-propylpiperidinehydrochloride;(S)-(-)-(3-methanesulfonyl-phenyl)-1-propyl-piperidine hydrochloride;(S,S)-3-[3-(Methylsulfonyl)phenyl]-1-propylpiperidine hydrochloride;PNU-0096391 | | CAS: | 156907-84-5 | | MF: | C15H23NO2S.ClH | | MW: | 317.879 | | EINECS: | | | Product Categories: | | | Mol File: | 156907-84-5.mol |  |
| | OSU6162hydrochloride Chemical Properties |
| storage temp. | Store at +4°C | | solubility | H2O: ≥16mg/mL | | form | powder | | color | white to tan | | Optical Rotation | [α]/D -5 to -7°, c = 1 in methanol | | Water Solubility | H2O: ≥16mg/mL | | InChI | 1S/C15H23NO2S.ClH/c1-3-9-16-10-5-7-14(12-16)13-6-4-8-15(11-13)19(2,17)18;/h4,6,8,11,14H,3,5,7,9-10,12H2,1-2H3;1H/t14-;/m1./s1 | | InChIKey | LEMGVHZVBREXAD-PFEQFJNWSA-N | | SMILES | Cl.CCCN1CCC[C@H](C1)c2cccc(c2)S(C)(=O)=O |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | OSU6162hydrochloride Usage And Synthesis |
| Uses | OSU 6162 Hydrochloride is a weak dopamine D2 receptor antagonist. It is a salt analogue of (-)-OSU (O006162). | | Biological Activity | Dopamine stabilizer that lacks high in vitro affinity for various neuroreceptors (K i values are 447 and 1305 nM for D 2 and D 3 receptors respectively and > 1 μ M for other targets). In vivo, shows high D 2 receptor occupancy and is highly active on dopamine synthesis and turnover. Induces stabilizing effects on psychomotor function in behavioral tests without inducing hypolocomotion or catalepsy. | | storage | Store at +4°C |
| | OSU6162hydrochloride Preparation Products And Raw materials |
|