| Company Name: |
RYSS TECH LTD |
| Tel: |
400-188-0725 +86 21 34310725 13611771617 |
| Email: |
|
1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one oxime manufacturers
|
| | 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one oxime Basic information |
| Product Name: | 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one oxime | | Synonyms: | 2,7,7-trimethyl-bicyclo(2.2.1)heptan-2-onoxime;2-bornanone,oxime;2-Camphanone oxime;2-camphanoneoxime;Bicyclo[2.2.1]heptan-2-one, 1,7,7-trimethyl-, oxime;Camphor, d-oxime;Kampferoxim;AKOS 92216 | | CAS: | 13559-66-5 | | MF: | C10H17NO | | MW: | 167.25 | | EINECS: | 236-945-2 | | Product Categories: | | | Mol File: | 13559-66-5.mol | ![1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one oxime Structure](CAS/GIF/13559-66-5.gif) |
| | 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one oxime Chemical Properties |
| Melting point | 110 °C | | InChI | InChI=1S/C10H17NO/c1-9(2)7-4-5-10(9,3)8(6-7)11-12/h7,12H,4-6H2,1-3H3 | | InChIKey | OVFDEGGJFJECAT-UHFFFAOYSA-N | | SMILES | C12(C)C(C)(C)C(CC1)CC2=NO | | LogP | 2.038 (est) | | EPA Substance Registry System | Camphor oxime (13559-66-5) |
| | 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one oxime Usage And Synthesis |
| | 1,7,7-Trimethylbicyclo[2.2.1]heptan-2-one oxime Preparation Products And Raw materials |
|