ALLOCHOLIC ACID manufacturers
- Allocholic acid
-
- $50.00
-
2026-05-11
- CAS:2464-18-8
- Purity: 97.20%
- Supply Ability: 10g
|
| | ALLOCHOLIC ACID Basic information |
| Product Name: | ALLOCHOLIC ACID | | Synonyms: | 3-A,7-A,12-A-TRIHYDROXY-5-A-CHOLANOIC ACID;ALLOCHOLIC ACID;(4R)-4-[(3R,5R,7R,8S,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid;3-α,7-α,12-α-Trihydroxy-5-α-cholanoic Acid;(5α)-Cholic acid;(4R)-4-[(3R,5R,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid;(4R)-4-[(3R,5R,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]valeric acid;system,vertebrates,fetal,olfactory,Allocholic acid,inhibit,olfactory system,metabolite,stimulant,isomer,Inhibitor,bile | | CAS: | 2464-18-8 | | MF: | C24H40O5 | | MW: | 408.57 | | EINECS: | | | Product Categories: | Steroids & Hormones - 13C & 2H;Metabolites;Steroids;Metabolites & Impurities | | Mol File: | 2464-18-8.mol |  |
| | ALLOCHOLIC ACID Chemical Properties |
| Melting point | 250-251 | | Boiling point | 583.9±50.0 °C(Predicted) | | density | 1.184±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly, Heated) | | form | Solid | | pka | 4.76±0.10(Predicted) | | color | White to Off-White | | InChIKey | BHQCQFFYRZLCQQ-PGHAKIONSA-N | | SMILES | O[C@H]1[C@@H]2[C@@H]([C@@]4([C@@H](C1)C[C@@H](CC4)O)C)C[C@@H]([C@]3([C@H]2CC[C@@H]3[C@@H](CCC(=O)O)C)C)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | ALLOCHOLIC ACID Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | Has wide-spread occurrence in a number of sources, including man as a major biliary metabolite | | Definition | ChEBI: Allocholic acid is an allo-bile acid that is 5alpha-cholan-24-oic acid bearing three alpha-hydroxy substituents at position 3, 7 and 12. It has a role as a marine metabolite, a rat metabolite and a human metabolite. It is a C24-steroid, a 3alpha-hydroxy steroid, a 7alpha-hydroxy steroid, a 12alpha-hydroxy steroid and an allo-bile acid. It is a conjugate acid of an allocholate. |
| | ALLOCHOLIC ACID Preparation Products And Raw materials |
|