| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3,4-Epoxycyclohexylmethyl acrylate manufacturers
|
| | 3,4-Epoxycyclohexylmethyl acrylate Basic information |
| Product Name: | 3,4-Epoxycyclohexylmethyl acrylate | | Synonyms: | 3,4-Epoxycyclohexylmethyl acrylate;2-Propenoic acid, 7-oxabicyclo4.1.0hept-3-ylmethyl ester;3,4-Epoxy-CycloheylMethyl-Acrylate;7-Oxabicyclo[4.1.0]hept-3-ylmethyl acrylate;7-Oxabicyclo[4.1.0]heptan-3-ylmethyl acrylate;(3,4-Epoxycyclohexyl)methyl Acrylate (stabilized with HQ);7-oxabicyclo[4.1.0]hept-3-ylmethyl prop-2-enoate;7-oxabicyclo[4.1.0]heptan-4-ylmethyl prop-2-enoate | | CAS: | 64630-63-3 | | MF: | C10H14O3 | | MW: | 182.22 | | EINECS: | | | Product Categories: | | | Mol File: | 64630-63-3.mol |  |
| | 3,4-Epoxycyclohexylmethyl acrylate Chemical Properties |
| Boiling point | 104 °C(Press: 2.4 Torr) | | density | 1.101±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C10H14O3/c1-2-10(11)12-6-7-3-4-8-9(5-7)13-8/h2,7-9H,1,3-6H2 | | InChIKey | DPTGFYXXFXSRIR-UHFFFAOYSA-N | | SMILES | C(OCC1CCC2C(O2)C1)(=O)C=C | | EPA Substance Registry System | 2-Propenoic acid, 7-oxabicyclo[4.1.0]hept-3-ylmethyl ester (64630-63-3) |
| | 3,4-Epoxycyclohexylmethyl acrylate Usage And Synthesis |
| Chemical Properties | Colorless transparent liquid |
| | 3,4-Epoxycyclohexylmethyl acrylate Preparation Products And Raw materials |
|