- Octenidine
-
- $2140.00 / 25mg
-
2026-04-21
- CAS:71251-02-0
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | Octenidine Basic information |
| Product Name: | Octenidine | | Synonyms: | N，N’-[1，10-Decanediyldi-1(4H)-pyridinyl-4-ylidene]-bis(1-octanamine);NeoKodan;Octeniderm;Octenisept;Win-41464;Win-41464-2;1,1'-Decamethylenebis(1,4-dihydro-4-(octylimino)pyridine);1,1'-(1,10-Decanediyl)bis[1,4-dihydro-4-(octylimino)pyridine] | | CAS: | 71251-02-0 | | MF: | C36H62N4 | | MW: | 550.9 | | EINECS: | | | Product Categories: | | | Mol File: | 71251-02-0.mol |  |
| | Octenidine Chemical Properties |
| Boiling point | 609.3±55.0 °C(Predicted) | | density | 0.94±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.60±0.70(Predicted) | | InChIKey | ZVXNYZWXUADSRV-UHFFFAOYSA-N | | SMILES | C(N1C=C/C(=N/CCCCCCCC)/C=C1)CCCCCCCCCN1C=C/C(=N/CCCCCCCC)/C=C1 |
| | Octenidine Usage And Synthesis |
| Chemical Properties | Octenidine Hydrochloride: C36H62N42HCl [70775-75-6]. Obtained as a solid from diethyl ether, melting point 215-217°C. | | Uses | Anti-infective, topical. | | Definition | ChEBI: Octenidine is a dihydropyridine. | | in vivo | Octenidine reduces bacterial counts on mice wounds and inhibit meticillin-resistant Staphylococcus aureus (MRSA)[3]. | Animal Model: | Mice (a six-millimetre punch full-thickness wound was inoculated with MRSA suspension)[3] | | Dosage: | | | Administration: | Administrated once 24 hours post-wounding | | Result: | Accelerated healing and reduced by >3.6 log cfu/g bacterial counts on the wounds relative to the PBS-treated control.
Exhibited lower burden of the inflammatory cells, more mature collagen fibres and well-defined epithelialisation.
Inhibited the expression of MRSA and its biofilm genes by nearly 100%. |
|
| | Octenidine Preparation Products And Raw materials |
|