|
|
| | Pyrimidifen Basic information |
| Product Name: | Pyrimidifen | | Synonyms: | -4-amine;4-pyrimidinamine,5-chloro-n-(2-(4-(2-ethoxyethyl)-2,3-dimethylphenoxy)ethyl)-6;5-chloro-n-(2-(4-(2-ethoxyethyl)-2,3-dimethylphenoxy)ethyl)-6-ethylpyrimidin;Pyrimedifen;SU-9118;MITECLEAN;pyrimidifen (bsi,iso);PYRIMIDIFEN STANDARD | | CAS: | 105779-78-0 | | MF: | C20H28ClN3O2 | | MW: | 377.91 | | EINECS: | | | Product Categories: | | | Mol File: | 105779-78-0.mol |  |
| | Pyrimidifen Chemical Properties |
| Melting point | 157-161℃ | | Boiling point | 535.6±50.0 °C(Predicted) | | density | 1.45 | | storage temp. | 0-6°C | | pka | 4.09±0.10(Predicted) | | BRN | 11644658 | | Henry's Law Constant | 3.6×104 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | Major Application | agriculture
environmental | | InChI | 1S/C20H28ClN3O2/c1-5-17-19(21)20(24-13-23-17)22-10-12-26-18-8-7-16(9-11-25-6-2)14(3)15(18)4/h7-8,13H,5-6,9-12H2,1-4H3,(H,22,23,24) | | InChIKey | ITKAIUGKVKDENI-UHFFFAOYSA-N | | SMILES | CCOCCc1ccc(OCCNc2ncnc(CC)c2Cl)c(C)c1C |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | UN2811 - class 6.1 - PG 3 - EHS - Toxic solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1 |
| | Pyrimidifen Usage And Synthesis |
| Uses | Pyrimidifen is used as pesticide. | | Uses | Pyrimidifen is used as a pesticide. | | Definition | ChEBI: Pyrimidifen is a pyrimidinamine insecticide, a pyrimidinamine acaricide and an aminopyrimidine. It has a role as a mitochondrial NADH:ubiquinone reductase inhibitor. | | Mechanism of action | Mitochondrial complex I electron transport inhibitor. Contact and stomach toxin. | | Synthesis | First, the key pyrimidine intermediate, 4,5-dichloro-6-ethylpyrimidine, was prepared. Simultaneously, an intermediate containing a phenoxyethyl side chain was prepared by reacting 4-(2-ethoxyethyl)-2,3-dimethylphenol with 1,2-dihaloethane or 2-haloethylamine. Subsequently, under basic conditions (e.g., using triethylamine or potassium carbonate) in an organic solvent, this pyrimidine intermediate underwent a nucleophilic substitution reaction with a side-chain amine intermediate to form an N-substituted pyrimidine-4-amine skeleton. Finally, by selective chlorination to ensure or introduce a chlorine atom at the 5-position, the Pyrimidifen was obtained. | | Pesticide Type | Insecticide; Acaricide |
| | Pyrimidifen Preparation Products And Raw materials |
|