|
|
| | dimesitylammonium pentafluorobenzenesulfonate Basic information |
| | dimesitylammonium pentafluorobenzenesulfonate Chemical Properties |
| storage temp. | Refrigerator | | form | powder to crystaline | | color | White to Orange to Green | | InChI | InChI=1S/C18H23N.C6HF5O3S/c1-11-7-13(3)17(14(4)8-11)19-18-15(5)9-12(2)10-16(18)6;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h7-10,19H,1-6H3;(H,12,13,14) | | InChIKey | MKKHTKBUMNIBLN-UHFFFAOYSA-N | | SMILES | C1(=C(F)C(=C(F)C(F)=C1F)F)S(O)(=O)=O.N(C1C(C)=CC(C)=CC=1C)C1=C(C)C=C(C)C=C1C |
| | dimesitylammonium pentafluorobenzenesulfonate Usage And Synthesis |
| Uses | Dimesitylammonium pentafluorobenzenesulfonate (CAS# 850629-65-1) is an organic catalyst, used in ester condensation reactions between alcohols and carboxylic acids. |
| | dimesitylammonium pentafluorobenzenesulfonate Preparation Products And Raw materials |
|