|
4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid Suppliers list
|
| Company Name: |
Career Henan Chemica Co |
| Tel: |
+86-0371-86658258 +86-13203830695 |
| Email: |
laboratory@coreychem.com |
| Products Intro: |
Product Name:4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid CAS:2304-89-4 Purity:95%~99.99% heidi@coreychem.com Package:1KG;2.8USD
|
|
|
|
|
- 4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid
-
-
2026-06-30
- CAS:2304-89-4
- Min. Order: 1KG
- Purity: 98.0%
- Supply Ability: 10000KGS
|
| | 4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid Basic information |
| Product Name: | 4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid | | Synonyms: | 4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid;7,12-dihydroxy-3-oxocholanic acid;3-Oxo-7α,12α-dihydroxy-5β-cholan-24-oic acid;3-Oxo-7α,12α-dihydroxycholanic acid;7α,12α-Dihydroxy-3-oxo-5β-cholanic acid;3-Oxo-7α,12α-hydroxy-5β-cholanoic Acid;3-Oxo Deoxycholic Acid;7alpha,12alpha-dihydroxy-3-oxo-5beta-cholan-24-oic acid | | CAS: | 2304-89-4 | | MF: | C24H38O5 | | MW: | 406.56 | | EINECS: | | | Product Categories: | | | Mol File: | 2304-89-4.mol | ![4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid Structure](CAS/GIF/2304-89-4.gif) |
| | 4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid Chemical Properties |
| Melting point | 185 °C | | Boiling point | 583.0±50.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly) | | pka | 4.76±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Beige | | Stability: | Hygroscopic | | InChIKey | OEKUSRBIIZNLHZ-DJDNIQJZSA-N | | SMILES | [H][C@@]12[C@]([C@](CCC(C3)=O)(C)[C@]3([H])C[C@H]2O)([H])C[C@H](O)[C@@]4(C)[C@@]1([H])CC[C@]4([H])[C@]([H])(C)CCC(O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid Usage And Synthesis |
| Uses | 3-Oxo-7α,12α-hydroxy-5β-cholanoic Acid is a keto bile acid derivative. | | Definition | ChEBI: A 3-oxo steroid that is cholic acid in which the hydroxy group at position 3 has undergone formal oxidation to the corresponding ketone. | | in vivo | Male Goto-Kakizaki (GK) rats rats are subjected to Ileal transposition (IT) surgery. In the metabolomics analysis, compared with Sham-IT rats, 3-Oxocholic acid of IT rats is increased[2]. |
| | 4-(7,12-dihydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-te tradecahydrocyclopenta[a]phenanthren-17-yl)pentanoic acid Preparation Products And Raw materials |
|