| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
1-(4,5-Methylenedioxy-2-nitrophenol)ethan-2-ol manufacturers
|
| | 1-(4,5-Methylenedioxy-2-nitrophenol)ethan-2-ol Basic information |
| | 1-(4,5-Methylenedioxy-2-nitrophenol)ethan-2-ol Chemical Properties |
| Melting point | 86.0 to 90.0 °C | | Boiling point | 393.3±42.0 °C(Predicted) | | density | 1.471±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 13.72±0.20(Predicted) | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C9H9NO5/c1-5(11)6-2-8-9(15-4-14-8)3-7(6)10(12)13/h2-3,5,11H,4H2,1H3 | | InChIKey | UHJMDARCOIYCHL-UHFFFAOYSA-N | | SMILES | C1(=CC2=C(OCO2)C=C1C(C)O)[N+](=O)[O-] |
| | 1-(4,5-Methylenedioxy-2-nitrophenol)ethan-2-ol Usage And Synthesis |
| Uses | 1-(4,5-METHYLENEDIOXY-2-NITROPHENOL)ETHAN-2-OL is an alcohol derivative used in organic synthesis and scientific research.
|
| | 1-(4,5-Methylenedioxy-2-nitrophenol)ethan-2-ol Preparation Products And Raw materials |
|