- Roseoside
-
- $1520.00
-
2026-05-11
- CAS:54835-70-0
- Purity:
- Supply Ability: 10g
|
| | roseoside Basic information |
| Product Name: | roseoside | | Synonyms: | -Dglucopyranosyloxy)- 1-butenyl]-4-hydroxy-3,5,- 5-triMethyl-,(4S)-;2-Cyclohexen-1-one,4-[(1E,3R)-3-(â;Roseoside A;Vomifoliol 9-glucoside;roseoside;(4S)-3-Methyl-4-hydroxy-4-[(1E,3R)-3-(β-D-glucopyranosyloxy)-1-butenyl]-5,5-dimethyl-2-cyclohexene-1-one;(S)-4-[(R,E)-3-(β-D-Glucopyranosyloxy)-1-butenyl]-4-hydroxy-3,5,5-trimethyl-2-cyclohexen-1-one;[(1R,2E)-1-Methyl-3-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxo-2-cyclohexenyl]-2-propenyl]β-D-glucopyranoside | | CAS: | 54835-70-0 | | MF: | C19H30O8 | | MW: | 386.44 | | EINECS: | | | Product Categories: | | | Mol File: | 54835-70-0.mol |  |
| | roseoside Chemical Properties |
| Boiling point | 595.9±50.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | pka | 12.52±0.60(Predicted) | | InChIKey | SWYRVCGNMNAFEK-KDCLJAHCNA-N | | SMILES | C1(=O)CC(C)(C)[C@@](O)(/C=C/[C@H](OC2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)C)C(C)=C1 |&1:6,10,13,15,17,19,r| |
| | roseoside Usage And Synthesis |
| Uses | Roseoside is a compound isolated from the leaves of Elaeocarpus japonicus[1]. | | References | [1] Shitamoto J, et al. Elaeocarpionoside, a megastigmane glucoside from the leaves of Elaeocarpus japonicus Sieb. et Zucc. J Nat Med. 2010;64(1):104-108. DOI:10.1007/s11418-009-0370-4 |
| | roseoside Preparation Products And Raw materials |
|