Bis(vinylsulfonyl)methane manufacturers
|
| | Bis(vinylsulfonyl)methane Basic information |
| Product Name: | Bis(vinylsulfonyl)methane | | Synonyms: | Ethene,1,1'-[Methylenebis(sulfonyl)]bis-;Bis(vinylsulfonyl);1,1’-[methylenebis(sulfonyl)]bis-ethen;bis(vinylsulphonyl)methane;1,1'-[methylenebis(sulfonyl)]bisethene;BIS(VINYLSULFONYL)METHANE;1,1'-[methylenebis(sulphonyl)]diethylene;11METHYLENEBISSULPHONYLBISETHENE | | CAS: | 3278-22-6 | | MF: | C5H8O4S2 | | MW: | 196.24 | | EINECS: | 221-909-0 | | Product Categories: | Pharmaceutical Intermediates | | Mol File: | 3278-22-6.mol |  |
| | Bis(vinylsulfonyl)methane Chemical Properties |
| Melting point | 62 °C | | Boiling point | 466.6±28.0 °C(Predicted) | | density | 1.369±0.06 g/cm3(Predicted) | | vapor pressure | 0.002-0.004Pa at 20-25℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | Solid:particulate/powder | | color | White | | InChI | InChI=1S/C5H8O4S2/c1-3-10(6,7)5-11(8,9)4-2/h3-4H,1-2,5H2 | | InChIKey | IJHIIHORMWQZRQ-UHFFFAOYSA-N | | SMILES | C(S(C=C)(=O)=O)S(C=C)(=O)=O | | LogP | -0.6--0.5 at 19.8℃ and pH6.6 | | CAS DataBase Reference | 3278-22-6(CAS DataBase Reference) | | EPA Substance Registry System | Ethene, 1,1'-[methylenebis(sulfonyl)]bis- (3278-22-6) |
| TSCA | TSCA listed | | HS Code | 2904.10.5000 |
| | Bis(vinylsulfonyl)methane Usage And Synthesis |
| Uses | Bis(vinylsulfonyl)methane (BVSM) can be used for:
(1) Medical gelatin scaffolds: as a cross-linking agent for biomacromolecules such as gelatin and proteins, to prevent the scaffold from degrading too rapidly within the body.
(2) Photographic materials: as a hardener for gelatin layers in the photographic film industry;
(3) Textile materials: for the modification of cellulose fibres, to enhance the crease resistance of fabrics or as a dye fixative. | | General Description | Bis(vinylsulfonyl)methane (BVSM) is a novel bifunctional cross-linking agent. It forms covalent C–N bonds with amine groups and has been widely used for the cross-linking (hardening) of gelatin. The hardening properties of these compounds are attributed to their propensity to undergo di-Michael addition reactions with nucleophilic groups in water-permeable, colloid-forming natural or synthetic polymers[1]. | | References | [1] A. Kende. (1996). SYNTHESIS OF SOME NOVEL FUNCTIONALIZED DOUBLE MICHAEL ACCEPTORS BASED ON bis(VINYLSULFONYL)METHANE (BVSM). Organic Preparations and Procedures International, 28 1, 683–690. https://doi.org/10.1080/00304949609356732 |
| | Bis(vinylsulfonyl)methane Preparation Products And Raw materials |
|