| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
norpseudopelleterine-N-oxyl manufacturers
|
| | norpseudopelleterine-N-oxyl Basic information |
| Product Name: | norpseudopelleterine-N-oxyl | | Synonyms: | 9-Azabicyclo[3.3.1]nonan-3-one N-oxyl, 95%;norpseudopelleterine-N-oxyl;KetoABNO 95%;(3-oxo-9-azabicyclo[3.3.1]non-9-yl)oxidanyl;9-oxidanyl-9-azabicyclo[3.3.1]nonan-3-one;9-oxidanyl-9-azabicyclo[3.3.1]nonan-3-one - [X87301];9-Azabicyclo[3,3,1]nonan-3-one-9oxyl (Keto ABNO);9-Azabicyclo[3.3.1]nonan-3-one N-oxyl | | CAS: | 7123-92-4 | | MF: | C8H12NO2 | | MW: | 154.19 | | EINECS: | 205-516-1 | | Product Categories: | | | Mol File: | 7123-92-4.mol |  |
| | norpseudopelleterine-N-oxyl Chemical Properties |
| Melting point | 109-114 °C | | storage temp. | 2-8°C | | form | powder | | Appearance | Light yellow to green yellow Solid | | InChI | 1S/C8H12NO2/c10-8-4-6-2-1-3-7(5-8)9(6)11/h6-7H,1-5H2 | | InChIKey | AMZBXNVXJGUYMF-UHFFFAOYSA-N | | SMILES | O=C1C[C@@H](N2[O])CCC[C@@H]2C1 |
| Risk Statements | 22-36/37/38 | | Safety Statements | 22-36/37 | | WGK Germany | WGK 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids |
| | norpseudopelleterine-N-oxyl Usage And Synthesis |
| Uses | Oxidant has been demonstrated in the application of aerobic oxidation of alcholols and amines at room temperature and ambient pressure. This product is also a convenient bench top stable solid. | | reaction suitability | reagent type: oxidant |
| | norpseudopelleterine-N-oxyl Preparation Products And Raw materials |
|