| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Avenanthramidea Basic information |
| Product Name: | Avenanthramidea | | Synonyms: | 5-Hydroxy-2-{[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propenyl]amino}benzoic acid;Avenanthramide Bp;N-(4′-Hydroxy-(E)-cinnamoyl)-5-hydroxyanthranilic acid;5-Hydroxy-2-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]benzoic acid;Benzoic acid, 5-hydroxy-2-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]-;(E)-5-Hydroxy-2-(3-(4-hydroxyphenyl)acrylamido)benzoic acid;Avenanthramidea | | CAS: | 108605-70-5 | | MF: | C16H13NO5 | | MW: | 299.28 | | EINECS: | | | Product Categories: | | | Mol File: | 108605-70-5.mol |  |
| | Avenanthramidea Chemical Properties |
| Melting point | 258-260°C | | Boiling point | 644.7±55.0 °C(Predicted) | | density | 1.490±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer | | solubility | Methanol (Slightly, Heated) | | form | Solid | | pka | 3.39±0.36(Predicted) | | color | Very Dark Yellow | | Stability: | Light Sensitive | | Cosmetics Ingredients Functions | SKIN PROTECTING
ANTIOXIDANT
HAIR CONDITIONING | | InChI | 1S/C16H13NO5/c18-11-4-1-10(2-5-11)3-8-15(20)17-14-7-6-12(19)9-13(14)16(21)22/h1-9,18-19H,(H,17,20)(H,21,22)/b8-3+ | | InChIKey | QGUMNWHANDITDB-FPYGCLRLSA-N | | SMILES | OC1=CC=C(NC(/C=C/C2=CC=C(O)C=C2)=O)C(C(O)=O)=C1 | | LogP | 2.910 (est) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Avenanthramidea Usage And Synthesis |
| Uses | Avenanthramide A performs a mild inhibitory activity on thrombin, trypsin, plasmin and papain. Avenanthramideis also an anti-inflammatory, antioxidant, anti-itch, anti-irritant and antiatherogenic agent. | | Definition | ChEBI: Avenanthramide A is a hydroxycinnamic acid. It is a conjugate acid of an avenanthramide A(1-). |
| | Avenanthramidea Preparation Products And Raw materials |
|