| Company Name: |
Puripharm Co., Ltd. |
| Tel: |
0572-2745768-1 13167223168;13167223168 |
| Email: |
sales@puripharm.com |
AVENANTHRAMIDEC manufacturers
- AVENANTHRAMIDEC
-
-
2026-02-02
- CAS:116764-15-9
- Min. Order: 1BOX
- Purity: 99%
- Supply Ability: 20tons
|
| | AVENANTHRAMIDEC Basic information |
| Product Name: | AVENANTHRAMIDEC | | Synonyms: | AVENANTHRAMIDEC;N-[3′,4′-Dihydroxy-(E)-cinnamoyl]-5-hydroxyanthranilic acid;2-{[(2E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propenyl]amino}-5-hydroxybenzoic acid;Avenanthramide Bc;Benzoic acid, 2-[[(2E)-3-(3,4-dihydroxyphenyl)-1-oxo-2-propen-1-yl]amino]-5-hydroxy-;(E)-2-(3-(3,4-Dihydroxyphenyl)acrylamido)-5-hydroxybenzoic acid;Avenanthramid C | | CAS: | 116764-15-9 | | MF: | C16H13NO6 | | MW: | 315.28 | | EINECS: | | | Product Categories: | | | Mol File: | 116764-15-9.mol |  |
| | AVENANTHRAMIDEC Chemical Properties |
| Melting point | 248-250°C (dec.) | | Boiling point | 702.3±60.0 °C(Predicted) | | density | 1.582±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Methanol (Slightly, Heated) | | pka | 3.37±0.36(Predicted) | | form | Solid | | color | Pale Yellow to Light Yellow | | BRN | 3624543 | | Cosmetics Ingredients Functions | ANTIOXIDANT
HAIR CONDITIONING
SKIN PROTECTING | | InChI | 1S/C16H13NO6/c18-10-3-4-12(11(8-10)16(22)23)17-15(21)6-2-9-1-5-13(19)14(20)7-9/h1-8,18-20H,(H,17,21)(H,22,23)/b6-2+ | | InChIKey | IDUUXROOZBOOPH-QHHAFSJGSA-N | | SMILES | OC1=CC=C(NC(/C=C/C2=CC(O)=C(O)C=C2)=O)C(C(O)=O)=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | AVENANTHRAMIDEC Usage And Synthesis |
| Uses | Avenanthramide C is an antioxidant and an anti-inflammatory agent. Avenanthramide reduces and attenuates proliferation of colonic cancer cells. Avenanthramide C inhibits chymotrypsin activity and moderately trypsin activity. | | Definition | ChEBI: 2-{[(2E)-3-(3,4-dihydroxyphenyl)-1-hydroxyprop-2-en-1-ylidene]amino}-5-hydroxybenzoic acid is an alkaloid and a member of benzamides. |
| | AVENANTHRAMIDEC Preparation Products And Raw materials |
|