| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 6-O-(tert-Butyldimethylsilyl)-D-galactal Basic information |
| | 6-O-(tert-Butyldimethylsilyl)-D-galactal Chemical Properties |
| Boiling point | 318.8±42.0 °C(Predicted) | | density | 1.054±0.06 g/cm3(Predicted) | | refractive index | n20/D 1.476(lit.) | | Fp | >230 °F | | storage temp. | -20°C | | pka | 12.79±0.60(Predicted) | | Optical Rotation | [α]23/D +7°, c = 1.4 in chloroform | | InChI | 1S/C12H24O4Si/c1-12(2,3)17(4,5)16-8-10-11(14)9(13)6-7-15-10/h6-7,9-11,13-14H,8H2,1-5H3/t9-,10-,11-/m1/s1 | | InChIKey | HYSBQWOHQIVUQQ-GMTAPVOTSA-N | | SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC=C[C@@H](O)[C@H]1O |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | 6-O-(tert-Butyldimethylsilyl)-D-galactal Usage And Synthesis |
| Uses | Important building block for both solution- and solid-phase synthesis of oligosaccharides. |
| | 6-O-(tert-Butyldimethylsilyl)-D-galactal Preparation Products And Raw materials |
|