|
|
| | 5-ACETOXYMETHYL-2-FURALDEHYDE Basic information |
| | 5-ACETOXYMETHYL-2-FURALDEHYDE Chemical Properties |
| Melting point | 53-55 °C (lit.) | | Boiling point | 122 °C / 2mmHg | | density | 1.230 | | refractive index | 1.4611 (estimate) | | Fp | 226 °F | | storage temp. | Freezer | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystals | | color | Brown | | Sensitive | Air Sensitive | | InChI | 1S/C8H8O4/c1-6(10)11-5-8-3-2-7(4-9)12-8/h2-4H,5H2,1H3 | | InChIKey | QAVITTVTXPZTSE-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(COC(C)=O)o1 | | CAS DataBase Reference | 10551-58-3(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29321900 | | Storage Class | 11 - Combustible Solids |
| | 5-ACETOXYMETHYL-2-FURALDEHYDE Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | 5-Acetoxymethyl-2-furaldehyde can be used for reduction of off-taste of vinegar. | | General Description | 5-Acetoxymethyl-2-furaldehyde is a volatile flavor compound present in berrycactus. It is a potential sweet modulator compound present in traditional balsamic vinegar of Modena. |
| | 5-ACETOXYMETHYL-2-FURALDEHYDE Preparation Products And Raw materials |
|