| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Bromo-3-methoxybenzonitrile Basic information |
| | 4-Bromo-3-methoxybenzonitrile Chemical Properties |
| Boiling point | 265.3±25.0 °C(Predicted) | | density | 1.56±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H6BrNO/c1-11-8-4-6(5-10)2-3-7(8)9/h2-4H,1H3 | | InChIKey | TWBFZKKJFREYES-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(Br)C(OC)=C1 |
| WGK Germany | WGK 3 | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-Bromo-3-methoxybenzonitrile Usage And Synthesis |
| | 4-Bromo-3-methoxybenzonitrile Preparation Products And Raw materials |
|