(-)-Epiafzelechin manufacturers
- (-)-Epiafzelechin
-
- $187.00 / 1mg
-
2025-11-02
- CAS:24808-04-6
- Min. Order:
- Purity: 99.45%
- Supply Ability: 10g
- (-)-Epiafzelechin
-
- $0.00 / 5mg
-
2023-02-24
- CAS:24808-04-6
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | (-)-Epiafzelechin Basic information |
| Product Name: | (-)-Epiafzelechin | | Synonyms: | (2R,3R)-2-(4-Hydroxyphenyl)-3,5,7-chromantriol;(2R,3R)-3,4-Dihydro-2-(4-hydroxyphenyl)-2H-1-benzopyran-3,5,7-triol;[2R,(-)]-3,4-Dihydro-2α-(4-hydroxyphenyl)-2H-1-benzopyran-3α,5,7-triol;(-) - epiaf catechin;2H-1-Benzopyran-3,5,7-triol,3,4-dihydro-2-(4-hydroxyphenyl)-, (2R,3R)-;(2R,3R)-2-(4-Hydroxyphenyl)-3,5,7-chromanetriol;(2R,3R)-2-(4-Hydroxyphenyl)chromane-3,5,7-triol | | CAS: | 24808-04-6 | | MF: | C15H14O5 | | MW: | 274.27 | | EINECS: | | | Product Categories: | | | Mol File: | 24808-04-6.mol |  |
| | (-)-Epiafzelechin Chemical Properties |
| Melting point | 241 °C (decomp) | | Boiling point | 583.4±50.0 °C(Predicted) | | density | 1.492±0.06 g/cm3(Predicted) | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | pka | 9?+-.0.60(Predicted) | | color | White to off-white | | InChI | InChI=1S/C15H14O5/c16-9-3-1-8(2-4-9)15-13(19)7-11-12(18)5-10(17)6-14(11)20-15/h1-6,13,15-19H,7H2/t13-,15-/m1/s1 | | InChIKey | RSYUFYQTACJFML-UKRRQHHQSA-N | | SMILES | [C@H]1(C2=CC=C(O)C=C2)OC2=CC(O)=CC(O)=C2C[C@H]1O | | LogP | 1.090 (est) |
| | (-)-Epiafzelechin Usage And Synthesis |
| Uses | (-)-Epiafzelechin in flavan-3-ols class of molecules. Considered to be a flavonoid lipid molecule it is found in high concentration in tea as well as fruits such as kiwis. | | Definition | ChEBI: (-)-epiafzelechin is a catechin derivative having (2R,3R)-configuration. It has a role as a plant metabolite. | | target | COX |
| | (-)-Epiafzelechin Preparation Products And Raw materials |
|