|
|
| | METHYL 3-HYDROXY-2-NITROBENZOATE Basic information |
| Product Name: | METHYL 3-HYDROXY-2-NITROBENZOATE | | Synonyms: | METHYL 3-HYDROXY-2-NITROBENZOATE;3-(Methoxycarbonyl)-2-nitrophenol, 2-Hydroxy-6-(methoxycarbonyl)nitrobenzene;3-Hydroxy-2-nitro-benzoic acid methyl ester;Benzoic acid, 3-hydroxy-2-nitro-, methyl ester;Benzoic acid, 3-hydroxy-2-nitro-, methyl ester (6CI, 7CI, 9CI, ACI);3-hydroxy-2-nitro-Benzoic acid methyl ester (6CI 7CI 9CI ACI) | | CAS: | 89942-77-8 | | MF: | C8H7NO5 | | MW: | 197.14 | | EINECS: | | | Product Categories: | Aromatic Esters | | Mol File: | 89942-77-8.mol |  |
| | METHYL 3-HYDROXY-2-NITROBENZOATE Chemical Properties |
| Melting point | 108-110℃ | | Boiling point | 310.0±22.0 °C(Predicted) | | density | 1.432±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | pka | 6.38±0.10(Predicted) | | color | Off white | | InChI | InChI=1S/C8H7NO5/c1-14-8(11)5-3-2-4-6(10)7(5)9(12)13/h2-4,10H,1H3 | | InChIKey | FHCNMPYMCKHBTK-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC(O)=C1[N+]([O-])=O |
| | METHYL 3-HYDROXY-2-NITROBENZOATE Usage And Synthesis |
| Synthesis | Sulfoxide chloride (SOCl2, 0.6 mL) was slowly added dropwise to anhydrous methanol (MeOH, 10 mL) at 0 °C. The reaction mixture was stirred continuously for 0.5 h at this temperature. Subsequently, 3-hydroxy-2-nitrobenzoic acid (0.6 g, 3.2 mmol) was added to the mixture. The reaction system was heated to reflux and maintained for 4 hours. The progress of the reaction was monitored by thin layer chromatography (TLC, unfolding agent ratio of petroleum ether: ethyl acetate = 1:1) to confirm the completion of the reaction. After completion of the reaction, the mixture was concentrated under vacuum to afford the target product methyl 2-nitro-3-hydroxybenzoate (0.63 g, 100% yield) as a brown solid. | | References | [1] Patent: WO2007/125405, 2007, A2. Location in patent: Page/Page column 24; 72-73
[2] Nippon Kagaku Zasshi, 1953, vol. 74, p. 251
[3] Chem.Abstr., 1954, p. 3959
[4] Patent: US2002/52397, 2002, A1
[5] Patent: US5756510, 1998, A |
| | METHYL 3-HYDROXY-2-NITROBENZOATE Preparation Products And Raw materials |
|