|
|
| | (2-Isopropyl-phenoxy)-acetic acid Basic information |
| | (2-Isopropyl-phenoxy)-acetic acid Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C11H14O3/c1-8(2)9-5-3-4-6-10(9)14-7-11(12)13/h3-6,8H,7H2,1-2H3,(H,12,13) | | InChIKey | HGGPCQVBKJMWHG-UHFFFAOYSA-N | | SMILES | O(CC(=O)O)c1c(cccc1)C(C)C |
| Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HS Code | 2918999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | (2-Isopropyl-phenoxy)-acetic acid Usage And Synthesis |
| Uses | 2-Isopropylphenoxy Acetic Acid is a chemical elicitors that induces resistance in rice to herbivores such as the white-backed planthopper Sogatella furcifera. |
| | (2-Isopropyl-phenoxy)-acetic acid Preparation Products And Raw materials |
|