| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 3-Chlorothiophene-2-boronic acid pinacol ester Basic information |
| Product Name: | 3-Chlorothiophene-2-boronic acid pinacol ester | | Synonyms: | 3-Chlorothiophene-2-boronic acid pinacol ester;2-(3-Chlorothiophen-2-yl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane;1,3,2-Dioxaborolane, 2-(3-chloro-2-thienyl)-4,4,5,5-tetramethyl-;3-Chlorothiophene-2-boronic acid pinacol ester, 95%,;2-(3-Chloro-2-thienyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | CAS: | 1040281-97-7 | | MF: | C10H14BClO2S | | MW: | 244.55 | | EINECS: | | | Product Categories: | | | Mol File: | 1040281-97-7.mol |  |
| | 3-Chlorothiophene-2-boronic acid pinacol ester Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | InChI | 1S/C10H14BClO2S/c1-9(2)10(3,4)14-11(13-9)8-7(12)5-6-15-8/h5-6H,1-4H3 | | InChIKey | UAAAZOFUOOBDBI-UHFFFAOYSA-N | | SMILES | ClC1=C(B2OC(C)(C)C(C)(C)O2)SC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3-Chlorothiophene-2-boronic acid pinacol ester Usage And Synthesis |
| | 3-Chlorothiophene-2-boronic acid pinacol ester Preparation Products And Raw materials |
|