| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 4-Methoxybenzylmagnesium chloride Basic information |
| Product Name: | 4-Methoxybenzylmagnesium chloride | | Synonyms: | 4-METHOXYBENZYLMAGNESIUM CHLORIDE, 0.25M S OLUTION IN TETRAHYDROFURAN;4-methoxybenzylmagnesium chloride solution;4-Methoxybenzylmagnesium chloride, 0.25M solution in THF, AcroSeal;4-MethoxybenzylMagnesiuM chloride, 0.25M in 2-MeTHF;4-Methoxybenzylmagnesium chloride,0.25M solution in THF;4-Methoxybenzylmagnesium chloride solution 0.25 in THF;4-MethoxybenzylMagnesiuM chloride, 0.25M solution in THF, J&KSeal;4-Methoxyphenylmethylmagnesium chloride | | CAS: | 38769-92-5 | | MF: | C8H9ClMgO | | MW: | 180.91 | | EINECS: | | | Product Categories: | Alkyl;Grignard Reagents;Organometallic Reagents | | Mol File: | 38769-92-5.mol |  |
| | 4-Methoxybenzylmagnesium chloride Chemical Properties |
| Boiling point | 65 °C | | density | 0.914 g/mL at 25 °C | | Fp | 1 °F | | storage temp. | 2-8°C | | form | Solution | | color | Yellow to dark brown | | Sensitive | Air & Moisture Sensitive | | InChI | InChI=1S/C8H9O.ClH.Mg/c1-7-3-5-8(9-2)6-4-7;;/h3-6H,1H2,2H3;1H;/q;;+1/p-1 | | InChIKey | XHDYUCUVUZSISM-UHFFFAOYSA-M | | SMILES | C(C1C=CC(OC)=CC=1)[Mg]Cl |
| | 4-Methoxybenzylmagnesium chloride Usage And Synthesis |
| Chemical Properties | Grey liquid | | reaction suitability | reaction type: Grignard Reaction |
| | 4-Methoxybenzylmagnesium chloride Preparation Products And Raw materials |
|