| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:(Z)-Metominostrobin
CAS:133408-51-2
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd.
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Paracetamol Impurity 57
CAS:133408-51-2
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing1@energy-chemical.com |
| Products Intro: |
Product Name:(Z)-Metominostrobin
CAS:133408-51-2
Purity:NULL Package:10mg;25mg;10mg Remarks:NULL
|
| Company Name: |
LGC Science (Shanghai) Ltd.
|
| Tel: |
17717235263 |
| Email: |
offer.de@lgcgroup.com |
| Products Intro: |
Product Name:(Z)-Metominostrobin
CAS:133408-51-2
Purity:具体纯度，见COA Package:100mg Remarks:TRC-M338758
|
|
| | (Z)-METOMINOSTROBIN Basic information |
| Product Name: | (Z)-METOMINOSTROBIN | | Synonyms: | (Z)-Metominostrobin PESTANAL;z-metominostrobin (bsi, pa iso);(Z)-2-Methoxyimino-N-methyl-2-(2-phenoxyphenyl)acetamide, (Z)-α-Methoxyimino-N-methyl-2-phenoxyphenylacetamide;(Z)-METOMINOSTROBIN;(Z)-Metominostrobin, 10 μg /μL in acetonitrile;(Z)-Metominostrobin Solution, 100ppm;Azoxystrobin (free acid), 10 μg /μL in acetonitrile;Triumizole-amino, 10 μg /μL in acetonitrile | | CAS: | 133408-51-2 | | MF: | C16H16N2O3 | | MW: | 284.31 | | EINECS: | | | Product Categories: | | | Mol File: | 133408-51-2.mol |  |
| | (Z)-METOMINOSTROBIN Chemical Properties |
| Melting point | 107～111℃ | | density | 1.13±0.1 g/cm3(Predicted) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 11.37±0.46(Predicted) | | color | Off-White | | Stability: | Moisture Sensitive | | Major Application | agriculture
environmental | | InChI | 1S/C16H16N2O3/c1-17-16(19)15(18-20-2)13-10-6-7-11-14(13)21-12-8-4-3-5-9-12/h3-11H,1-2H3,(H,17,19)/b18-15- | | InChIKey | HIIRDDUVRXCDBN-SDXDJHTJSA-N | | SMILES | CNC(=O)C(=N/OC)\c1ccccc1Oc2ccccc2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (Z)-METOMINOSTROBIN Usage And Synthesis |
| Uses | (Z)-Metominostrobin (cas# 133408-51-2) is a compound useful in organic synthesis. |
| | (Z)-METOMINOSTROBIN Preparation Products And Raw materials |
|