|
|
| | Potassium 3-trifluoroboratopropionate tert-butyl ester Basic information |
| Product Name: | Potassium 3-trifluoroboratopropionate tert-butyl ester | | Synonyms: | Potassium 3-trifluoroboratopropionate tert-butyl ester;CHEMMAKER CMBC-00993;Borate(1-), [3-(1,1-dimethylethoxy)-3-oxopropyl]trifluoro-, potassium (1:1), (T-4)-;potassium:trifluoro-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]boranuide;potassium:trifluoro-[3-[(2-methylpropan-;PotassiuM 3-trifluoroboratopropanoate tert-butyl ester;potassium,trifluoro-[3-[(2-methylpropan-2-yl)oxy]-3-oxopr;(3-tert-butoxy-3-oxo-propyl)-trifluoro-boranuide potassium | | CAS: | 1023357-66-5 | | MF: | C7H13BF3KO2 | | MW: | 236.0814296 | | EINECS: | | | Product Categories: | Molander Ates;Organoborons | | Mol File: | 1023357-66-5.mol |  |
| | Potassium 3-trifluoroboratopropionate tert-butyl ester Chemical Properties |
| Melting point | >200 °C | | storage temp. | 2-8°C, stored under nitrogen, away from moisture | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H13BF3O2.K/c1-7(2,3)13-6(12)4-5-8(9,10)11;/h4-5H2,1-3H3;/q-1;+1 | | InChIKey | SCIFNXNSQDOFML-UHFFFAOYSA-N | | SMILES | [K+].[B-](F)(F)(F)CCC(OC(C)(C)C)=O |
| | Potassium 3-trifluoroboratopropionate tert-butyl ester Usage And Synthesis |
| | Potassium 3-trifluoroboratopropionate tert-butyl ester Preparation Products And Raw materials |
|