|
|
| | 2-PHENYLPROPANE-1,1,1,2,3,3,3-D7 Basic information |
| Product Name: | 2-PHENYLPROPANE-1,1,1,2,3,3,3-D7 | | Synonyms: | 2-Phenylpropane-d7;ISOPROPYL-D7-BENZENE;CUMENE-ISOPROPYL-D7;2-PHENYLPROPANE-1,1,1,2,3,3,3-D7;Cumene-D7;Isopropyl-d7-benzene | | CAS: | 20201-28-9 | | MF: | C9H5D7 | | MW: | 127.24 | | EINECS: | | | Product Categories: | | | Mol File: | 20201-28-9.mol |  |
| | 2-PHENYLPROPANE-1,1,1,2,3,3,3-D7 Chemical Properties |
| Boiling point | 152-154 °C | | density | 0.914 g/mL at 25 °C | | Fp | 31 °C | | InChI | 1S/C9H12/c1-8(2)9-6-4-3-5-7-9/h3-8H,1-2H3/i1D3,2D3,8D | | InChIKey | RWGFKTVRMDUZSP-UNAVHCQLSA-N | | SMILES | [2H]C([2H])([2H])C([2H])(c1ccccc1)C([2H])([2H])[2H] |
| Hazard Codes | Xn,N,Xi | | Risk Statements | 10-37-51/53-65 | | Safety Statements | 24-37-61-62 | | RIDADR | UN 1918 3/PG 3 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 2 Asp. Tox. 1 Flam. Liq. 3 STOT SE 3 |
| | 2-PHENYLPROPANE-1,1,1,2,3,3,3-D7 Usage And Synthesis |
| Uses | Cumene-D7 is the dueterated isotope of Cumene (C834590). Cumene is used in the studies relating to polymer monolayers and polystyrene nanocapsules. |
| | 2-PHENYLPROPANE-1,1,1,2,3,3,3-D7 Preparation Products And Raw materials |
|