1,2,4-TRIS(METHANESULFONYLOXY)BUTANE manufacturers
|
| | 1,2,4-TRIS(METHANESULFONYLOXY)BUTANE Basic information |
| Product Name: | 1,2,4-TRIS(METHANESULFONYLOXY)BUTANE | | Synonyms: | 1,2,4-TRIS(METHANESULFONYLOXY)BUTANE;1,2,4-BUTANETRIOL TRIMETHANESULFONATE;Trismethanesulfonyloxybutane;1,2,4-TRIS(METHANESULFONYLOXY)BUTANE 95+%;1,2,4-Butanetriol, 1,2,4-trimethanesulfonate;3-[(Methylsulfonyl)oxy]-1-{[(methylsulfonyl)oxy]methyl}propyl methanesulfonate | | CAS: | 108963-16-2 | | MF: | C7H16O9S3 | | MW: | 340.4 | | EINECS: | | | Product Categories: | | | Mol File: | 108963-16-2.mol |  |
| | 1,2,4-TRIS(METHANESULFONYLOXY)BUTANE Chemical Properties |
| Melting point | 64 °C | | Boiling point | 638.192±50.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.502±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | InChI=1S/C8H13N3/c1-11-5-4-10-8(11)7(9)6-2-3-6/h4-7H,2-3,9H2,1H3 | | InChIKey | YJIUOKPKBPEIMF-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(OC(CO[S](=O)(=O)C)CCO[S](=O)(=O)C)C |
| WGK Germany | WGK 3 | | HS Code | 2904100090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1,2,4-TRIS(METHANESULFONYLOXY)BUTANE Usage And Synthesis |
| | 1,2,4-TRIS(METHANESULFONYLOXY)BUTANE Preparation Products And Raw materials |
|