H-Asp-Tyr-Met-Gly-Trp-Met-Asp-Phe-NH2 manufacturers
|
| | H-Asp-Tyr-Met-Gly-Trp-Met-Asp-Phe-NH2 Basic information |
| | H-Asp-Tyr-Met-Gly-Trp-Met-Asp-Phe-NH2 Chemical Properties |
| Boiling point | 1570.2±65.0 °C(Predicted) | | density | 1.387±0.06 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Soluble to 1 mg/ml in 10% acetonitrile / water | | form | powder | | pka | 3.71±0.10(Predicted) | | color | White to off-white | | Sequence | Asp-Tyr-Met-Gly-Trp-Met-Asp-Phe-NH2 | | InChIKey | OIXQINQYMGNCII-UHFFFAOYSA-N | | SMILES | CSCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CC(O)=O)C(=O)NCC(=O)NC(Cc2c[nH]c3ccccc23)C(=O)NC(CCSC)C(=O)NC(CC(O)=O)C(=O)NC(Cc4ccccc4)C(N)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-Asp-Tyr-Met-Gly-Trp-Met-Asp-Phe-NH2 Usage And Synthesis |
| Uses | Cholecystokinin (CCK) Fragment 26-33 Amide, Non-sulfated has been used in the specificity testing against gastrin and pepsinogen I proteins. | | Definition | ChEBI: Asp-Tyr-Met-Gly-Trp-Met-Asp-Phe-NH2 is an eight-membered oligopeptide consisting of Asp, Tyr, Met, Gly, Trp, Met, As and Phe-NH2 residues joined in sequence. It has a role as a human metabolite, a rat metabolite and a mouse metabolite. It is an oligopeptide and a peptidyl amide. | | Biochem/physiol Actions | Biologically inactive form of CCK-8; CCKB/gastrin receptor agonist that has no activity at the CCKA receptor. |
| | H-Asp-Tyr-Met-Gly-Trp-Met-Asp-Phe-NH2 Preparation Products And Raw materials |
|