|
|
| | (R)-(-)-3-HYDROXYBUTYRIC ACID, SODIUM SALT Basic information |
| | (R)-(-)-3-HYDROXYBUTYRIC ACID, SODIUM SALT Chemical Properties |
| Melting point | 149-155 °C(lit.) | | storage temp. | Inert atmosphere,2-8°C | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]22/D 14°, c = 10 in H2O | | Water Solubility | Water: 100 mg/mL (793.08 mM) | | BRN | 6118796 | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | ANTI-SEBUM SKIN CONDITIONING - HUMECTANT PLASTICISER SKIN CONDITIONING - MISCELLANEOUS | | InChI | InChI=1/C4H8O3.Na.H/c1-3(5)2-4(6)7;;/h3,5H,2H2,1H3,(H,6,7);;/t3-;;/s3 | | InChIKey | DIKSWKJUJFMKBT-LPWWCTNINA-N | | SMILES | C(C(=O)O)[C@H](O)C.[NaH] |&1:4,r| |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids |
| | (R)-(-)-3-HYDROXYBUTYRIC ACID, SODIUM SALT Usage And Synthesis |
| Chemical Properties | mp 165-167°C | | Uses | chiral synthon | | Uses | (R)-(-)-3-Hydroxybutyric acid sodium salt reacts with crown ether to form a supramolecular complex, which can catalyze the regioselective ring-opening polymerization of (S)-butyrolactone to form (R)-3-hydroxybutyrate oligomers (OHBs). | | Uses | Optically active 3-hydroxybutyric acids are key intermediates of the biosynthesis and metabolism of fatty acids and exist widely in biological systems. | | Synthesis | In a 500 mL three-necked flask, methyl (R)-3-hydroxybutyrate (76.0 g) made from Example 1 was added, followed by 300 mL of water. The reaction temperature was controlled to be below 30 °C, and sodium hydroxide (25.8 g) was added slowly in batches over a period of 3 hours. After addition, maintain the temperature no higher than 10°C and continue to stir the reaction for 3 hours until the reaction is complete. Add 0.3 g of activated carbon and filter after continuous stirring for 0.5 hours. The filtrate was concentrated to 100 mL, at which time a large amount of solid precipitated. Crystallization was stirred at room temperature for 1 hour, centrifuged and dried in vacuum to obtain 68.9 g of (R)-(-)-3-hydroxybutyric acid sodium salt as a white solid with a yield of 85.0% and an ee value of 91.5%. | | References | [1] Patent: CN107162893, 2017, A. Location in patent: Paragraph 0042; 0043 |
| | (R)-(-)-3-HYDROXYBUTYRIC ACID, SODIUM SALT Preparation Products And Raw materials |
|