| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Estriol-16beta-D-glucopyranosiduronic acid Basic information |
| Product Name: | Estriol-16beta-D-glucopyranosiduronic acid | | Synonyms: | 3,16ALPHA,17BETA-TRIHYDROXY-1,3,5[10]-ESTRATRIENE 16-GLUCURONIDE;estriol 16A-(B-D-glucuronide);1,3,5(10)-estratriene-3,16α,17β-triol 16-glucuronide;1,3,5(10)-ESTRATRIEN-3,16-ALPHA, 17-BETA-TRIOL 16-GLUCOSIDURONATE;1,3,5[10]-ESTRATRIENE-3,16ALPHA,17BETA-TRIOL 16-GLUCURONIDE;Estriol-16beta-D-glucopyranosiduronic acid;oestriol 16alpha-(beta-D-glucuronide);1,3,5(10)-Estratriene-3,16α,17β-triol 16-glucuronide, 3,16α,17β-Trihydroxy-1,3,5(10)-estratriene 16-glucuronide | | CAS: | 1852-50-2 | | MF: | C24H32O9 | | MW: | 464.51 | | EINECS: | | | Product Categories: | | | Mol File: | 1852-50-2.mol |  |
| | Estriol-16beta-D-glucopyranosiduronic acid Chemical Properties |
| Boiling point | 738.3±60.0 °C(Predicted) | | density | 1.51±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | ethanol: water (1:1): 10mg/mL, clear to very slightly hazy, colorless | | pka | 2.82±0.70(Predicted) | | form | powder | | BRN | 67674 | | InChIKey | FQYGGFDZJFIDPU-JRSYHJKYSA-N | | SMILES | [H][C@]12CC[C@]3(C)[C@@H](O)[C@@H](C[C@@]3([H])[C@]1([H])CCc4cc(O)ccc24)O[C@@H]5O[C@@H]([C@@H](O)[C@H](O)[C@H]5O)C(O)=O |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 36/37 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | Estriol-16beta-D-glucopyranosiduronic acid Usage And Synthesis |
| Uses | Estriol-d5 16-O-β-D-Glucuronide is the labeled analogue of Estriol 16-O-β-D-Glucuronide (E888965), a glucuronide derivative of Estriol (E888960); a metabolite of Estradiol that is considerably less potent than Estradiol itself. | | Definition | ChEBI: Estriol 16-O-(beta-D-glucuronide) is a steroid glucosiduronic acid that is estriol in which the phenolic hydrogen has been replaced by a beta-D-glucuronyl residue. It has a role as a human urinary metabolite. It is a steroid glucosiduronic acid, a beta-D-glucosiduronic acid, a 3-hydroxy steroid, a member of phenols and a 17beta-hydroxy steroid. It is functionally related to an estriol. It is a conjugate acid of an estriol 16-O-(beta-D-glucuronide)(1-). |
| | Estriol-16beta-D-glucopyranosiduronic acid Preparation Products And Raw materials |
|