| Company Name: |
Heterochem |
| Tel: |
027-88041443 13072715837 |
| Email: |
sales@hetero-chem.com |
2-Methyl-3-oxo-3-phenyl-propionic acid ethyl ester manufacturers
|
| | 2-Methyl-3-oxo-3-phenyl-propionic acid ethyl ester Basic information |
| Product Name: | 2-Methyl-3-oxo-3-phenyl-propionic acid ethyl ester | | Synonyms: | Ethyl 2-benzoylpropanoate;Ethyl 2-benzoylpropionate;Ethyl 2-methyl-3-oxo-3-phenylpropionate;Ethyl alpha-benzoylpropionate;a-Methyl-b-oxo-benzenepropanoic acid ethyl ester;Propionic acid, 2-benzoyl-, ethyl ester;Ethyl2-methyl-3-oxo-3-phenylpropanoate;Ethyl 2-Benzoylpropionate > | | CAS: | 10488-87-6 | | MF: | C12H14O3 | | MW: | 206.24 | | EINECS: | | | Product Categories: | | | Mol File: | 10488-87-6.mol |  |
| | 2-Methyl-3-oxo-3-phenyl-propionic acid ethyl ester Chemical Properties |
| Boiling point | 279℃ | | density | 1.080 | | refractive index | 1.5070 to 1.5110 | | Fp | 118℃ | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | pka | 10.93±0.26(Predicted) | | color | Light orange to Yellow to Green | | InChI | InChI=1S/C12H14O3/c1-3-15-12(14)9(2)11(13)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3 | | InChIKey | RAWGHPXIJSCHFZ-UHFFFAOYSA-N | | SMILES | C1(C=CC=CC=1)C(=O)C(C)C(=O)OCC |
| | 2-Methyl-3-oxo-3-phenyl-propionic acid ethyl ester Usage And Synthesis |
| | 2-Methyl-3-oxo-3-phenyl-propionic acid ethyl ester Preparation Products And Raw materials |
|