| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Ethiofencarb sulfone CAS:53380-23-7 Purity:100 μg/ML in AcCN Package:1ML
|
| Company Name: |
Shanghai BeiZhuo Biotech Co., Ltd.
|
| Tel: |
021-61119791,13386096464 |
| Email: |
bzswkf@foxmail.com |
| Products Intro: |
Product Name:2-[(ethylsulfonyl)Methyl]phenyl MethylcarbaMate CAS:53380-23-7 Purity:99%HPLC
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:Ethiofencarb-sulfone CAS:53380-23-7 Purity:98% 10Mg 25Mg 100Mg
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Ethiofencarb sulfone CAS:53380-23-7 Purity:99% Package:10mg;100mg;1g
|
|
| | ETHIOFENCARB-SULFONE Basic information |
| | ETHIOFENCARB-SULFONE Chemical Properties |
| Boiling point | 449.4±45.0 °C(Predicted) | | density | 1.247±0.06 g/cm3(Predicted) | | storage temp. | APPROX 4°C | | pka | 11.96±0.46(Predicted) | | BRN | 1988595 | | Major Application | agriculture environmental | | InChI | 1S/C11H15NO4S/c1-3-17(14,15)8-9-6-4-5-7-10(9)16-11(13)12-2/h4-7H,3,8H2,1-2H3,(H,12,13) | | InChIKey | IOPTXXRNXCPJGO-UHFFFAOYSA-N | | SMILES | CCS(=O)(=O)Cc1ccccc1OC(=O)NC | | EPA Substance Registry System | Phenol, 2-[(ethylsulfonyl)methyl]-, 1-(N-methylcarbamate) (53380-23-7) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | RTECS | SL4506500 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | ETHIOFENCARB-SULFONE Usage And Synthesis |
| Uses | Ethiofencarb Sulfone is a metabolite of Croneton, a carbamate insecticide. | | Definition | ChEBI: 2-(Ethylsulfonylmethyl)phenyl methylcarbamate is a carbamate ester. |
| | ETHIOFENCARB-SULFONE Preparation Products And Raw materials |
|