| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Anisole-13C6 Basic information |
| | Anisole-13C6 Chemical Properties |
| Melting point | -37 °C(lit.) | | Boiling point | 154 °C(lit.) | | density | 1.049 g/mL at 25 °C | | Fp | 51°C | | solubility | soluble in Dichloromethane, Ethyl Acetate | | form | Oil | | color | Pale Yellow | | InChI | 1S/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3/i2+1,3+1,4+1,5+1,6+1,7+1 | | InChIKey | RDOXTESZEPMUJZ-WBJZHHNVSA-N | | SMILES | CO[13c]1[13cH][13cH][13cH][13cH][13cH]1 |
| Risk Statements | 10 | | RIDADR | UN 2222 3 / PGIII | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 |
| | Anisole-13C6 Usage And Synthesis |
| Chemical Properties | Pale Yellow Oil | | Uses | Labelled Anisole, Anisole-13C6 is used in perfumery. |
| | Anisole-13C6 Preparation Products And Raw materials |
|